C16H17N5O3 — CID 86843294
N-[4-[(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)amino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 86843294) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-[4-[(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)amino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)amino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86843294 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | N-[4-[(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)amino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | Cc1[nH]nc2ncc(NC(=O)CCCNC(=O)c3ccco3)cc12 |
| InChI | InChI=1S/C16H17N5O3/c1-10-12-8-11(9-18-15(12)21-20-10)19-14(22)5-2-6-17-16(23)13-4-3-7-24-13/h3-4,7-9H,2,5-6H2,1H3,(H,17,23)(H,19,22)(H,18,20,21) |
| InChIKey | BBIOHSNQDJCLPE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|