C19H22F3N3O3 — CID 86849744
4-(3,5-dimethylpiperidin-1-yl)-3-nitro-N-prop-2-ynyl-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 86849744) has the molecular formula C19H22F3N3O3 and a molecular weight of 397.40 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)-3-nitro-N-prop-2-ynyl-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)-3-nitro-N-prop-2-ynyl-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 86849744 |
| Molecular Formula | C19H22F3N3O3 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)-3-nitro-N-prop-2-ynyl-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | C#CCN(CC(F)(F)F)C(=O)c1ccc(N2CC(C)CC(C)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H22F3N3O3/c1-4-7-23(12-19(20,21)22)18(26)15-5-6-16(17(9-15)25(27)28)24-10-13(2)8-14(3)11-24/h1,5-6,9,13-14H,7-8,10-12H2,2-3H3 |
| InChIKey | HFDZQKQEYZTVDP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|