C18H16N2O3S2 — CID 86856851
2-thiophen-2-ylethyl 2-(2-benzamido-1,3-thiazol-4-yl)acetate (PubChem CID 86856851) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 2-(2-benzamido-1,3-thiazol-4-yl)acetate.
| Compound Name | 2-thiophen-2-ylethyl 2-(2-benzamido-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 86856851 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-thiophen-2-ylethyl 2-(2-benzamido-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1csc(NC(=O)c2ccccc2)n1)OCCc1cccs1 |
| InChI | InChI=1S/C18H16N2O3S2/c21-16(23-9-8-15-7-4-10-24-15)11-14-12-25-18(19-14)20-17(22)13-5-2-1-3-6-13/h1-7,10,12H,8-9,11H2,(H,19,20,22) |
| InChIKey | MBKSZCPIMRRJEA-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |