C23H29F2N3O3 — CID 86883222
3-[1-[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]piperidin-3-yl]propanamide (PubChem CID 86883222) has the molecular formula C23H29F2N3O3 and a molecular weight of 433.50 g/mol. Its IUPAC name is 3-[1-[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]piperidin-3-yl]propanamide.
| Compound Name | 3-[1-[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 86883222 |
| Molecular Formula | C23H29F2N3O3 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 3-[1-[2-[1-[4-(difluoromethoxy)phenyl]-2,5-dimethylpyrrol-3-yl]-2-oxoethyl]piperidin-3-yl]propanamide |
| SMILES | Cc1cc(C(=O)CN2CCCC(CCC(N)=O)C2)c(C)n1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H29F2N3O3/c1-15-12-20(16(2)28(15)18-6-8-19(9-7-18)31-23(24)25)21(29)14-27-11-3-4-17(13-27)5-10-22(26)30/h6-9,12,17,23H,3-5,10-11,13-14H2,1-2H3,(H2,26,30) |
| InChIKey | MGZBCRHHZLUTTC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|