C23H31N3O4 — CID 86972462
N-[3-[[(2-tert-butyloxan-3-yl)methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide (PubChem CID 86972462) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[3-[[(2-tert-butyloxan-3-yl)methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[(2-tert-butyloxan-3-yl)methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86972462 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | N-[3-[[(2-tert-butyloxan-3-yl)methylcarbamoylamino]methyl]phenyl]furan-2-carboxamide |
| SMILES | CC(C)(C)C1OCCCC1CNC(=O)NCc1cccc(NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C23H31N3O4/c1-23(2,3)20-17(8-5-12-30-20)15-25-22(28)24-14-16-7-4-9-18(13-16)26-21(27)19-10-6-11-29-19/h4,6-7,9-11,13,17,20H,5,8,12,14-15H2,1-3H3,(H,26,27)(H2,24,25,28) |
| InChIKey | HESMINATXZMIRU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |