C24H25FN4O2 — CID 87045411
[4-[1-(3-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]-pyridin-4-ylmethanone (PubChem CID 87045411) has the molecular formula C24H25FN4O2 and a molecular weight of 420.49 g/mol. Its IUPAC name is [4-[1-(3-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]-pyridin-4-ylmethanone.
| Compound Name | [4-[1-(3-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]-pyridin-4-ylmethanone |
|---|---|
| PubChem CID | 87045411 |
| Molecular Formula | C24H25FN4O2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | [4-[1-(3-fluorophenyl)-2,5-dimethylpyrrole-3-carbonyl]-1,4-diazepan-1-yl]-pyridin-4-ylmethanone |
| SMILES | Cc1cc(C(=O)N2CCCN(C(=O)c3ccncc3)CC2)c(C)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C24H25FN4O2/c1-17-15-22(18(2)29(17)21-6-3-5-20(25)16-21)24(31)28-12-4-11-27(13-14-28)23(30)19-7-9-26-10-8-19/h3,5-10,15-16H,4,11-14H2,1-2H3 |
| InChIKey | FTQOCGNVZMFETM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|