C19H22F3N3O3S2 — CID 87059078
4-amino-2-[4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 87059078) has the molecular formula C19H22F3N3O3S2 and a molecular weight of 461.53 g/mol. Its IUPAC name is 4-amino-2-[4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
| Compound Name | 4-amino-2-[4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87059078 |
| Molecular Formula | C19H22F3N3O3S2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | 4-amino-2-[4-[4-[(2S)-1,1,1-trifluoro-2-hydroxypropan-2-yl]phenyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | C[C@](O)(c1ccc(N2CCN(S(=O)(=O)C3=CC(N)=CCC3=S)CC2)cc1)C(F)(F)F |
| InChI | InChI=1S/C19H22F3N3O3S2/c1-18(26,19(20,21)22)13-2-5-15(6-3-13)24-8-10-25(11-9-24)30(27,28)17-12-14(23)4-7-16(17)29/h2-6,12,26H,7-11,23H2,1H3/t18-/m0/s1 |
| InChIKey | KNEKFYZYRZPUKD-SFHVURJKSA-N |
| XLogP | 2.41 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|