C26H25F6N3O4S2 — CID 87059153
2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-[(2-methoxy-4-pyridinyl)methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 87059153) has the molecular formula C26H25F6N3O4S2 and a molecular weight of 621.63 g/mol. Its IUPAC name is 2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-[(2-methoxy-4-pyridinyl)methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
| Compound Name | 2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-[(2-methoxy-4-pyridinyl)methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87059153 |
| Molecular Formula | C26H25F6N3O4S2 |
| Molecular Weight | 621.63 g/mol |
| Exact Mass | 621.12 |
| IUPAC Name | 2-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-[(2-methoxy-4-pyridinyl)methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | COc1cc(CC2CN(S(=O)(=O)C3=CC=CCC3=S)CCN2c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)ccn1 |
| InChI | InChI=1S/C26H25F6N3O4S2/c1-39-23-15-17(10-11-33-23)14-20-16-34(41(37,38)22-5-3-2-4-21(22)40)12-13-35(20)19-8-6-18(7-9-19)24(36,25(27,28)29)26(30,31)32/h2-3,5-11,15,20,36H,4,12-14,16H2,1H3 |
| InChIKey | WUXUWEYMIOOZBI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.63 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|