C27H26F6N2O4S2 — CID 87059220
2-[(3S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-[(3-methoxyphenyl)methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 87059220) has the molecular formula C27H26F6N2O4S2 and a molecular weight of 620.64 g/mol. Its IUPAC name is 2-[(3S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-[(3-methoxyphenyl)methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
| Compound Name | 2-[(3S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-[(3-methoxyphenyl)methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
|---|---|
| PubChem CID | 87059220 |
| Molecular Formula | C27H26F6N2O4S2 |
| Molecular Weight | 620.64 g/mol |
| Exact Mass | 620.12 |
| IUPAC Name | 2-[(3S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-[(3-methoxyphenyl)methyl]piperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | COc1cccc(C[C@H]2CN(S(=O)(=O)C3=CC=CCC3=S)CCN2c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C27H26F6N2O4S2/c1-39-22-6-4-5-18(16-22)15-21-17-34(41(37,38)24-8-3-2-7-23(24)40)13-14-35(21)20-11-9-19(10-12-20)25(36,26(28,29)30)27(31,32)33/h2-6,8-12,16,21,36H,7,13-15,17H2,1H3/t21-/m0/s1 |
| InChIKey | YFHPIJMBFIMAOD-NRFANRHFSA-N |
| XLogP | 5.28 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|