C18H31O2P — CID 87069120
2,3,5-tributyl-6-phosphanylbenzene-1,4-diol (PubChem CID 87069120) has the molecular formula C18H31O2P and a molecular weight of 310.42 g/mol. Its IUPAC name is 2,3,5-tributyl-6-phosphanylbenzene-1,4-diol.
| Compound Name | 2,3,5-tributyl-6-phosphanylbenzene-1,4-diol |
|---|---|
| PubChem CID | 87069120 |
| Molecular Formula | C18H31O2P |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2,3,5-tributyl-6-phosphanylbenzene-1,4-diol |
| SMILES | CCCCc1c(O)c(CCCC)c(CCCC)c(O)c1P |
| InChI | InChI=1S/C18H31O2P/c1-4-7-10-13-14(11-8-5-2)17(20)18(21)15(16(13)19)12-9-6-3/h19-20H,4-12,21H2,1-3H3 |
| InChIKey | BTVKMWFSKOVEPY-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|