C42H84ClNO2 — CID 87069349
(Z)-1-[1-chloro-1-[(Z)-octadec-9-enoxy]propan-2-yl]oxyoctadec-9-ene;N,N-dimethylmethanamine (PubChem CID 87069349) has the molecular formula C42H84ClNO2 and a molecular weight of 670.59 g/mol. Its IUPAC name is (Z)-1-[1-chloro-1-[(Z)-octadec-9-enoxy]propan-2-yl]oxyoctadec-9-ene;N,N-dimethylmethanamine.
| Compound Name | (Z)-1-[1-chloro-1-[(Z)-octadec-9-enoxy]propan-2-yl]oxyoctadec-9-ene;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 87069349 |
| Molecular Formula | C42H84ClNO2 |
| Molecular Weight | 670.59 g/mol |
| Exact Mass | 669.62 |
| IUPAC Name | (Z)-1-[1-chloro-1-[(Z)-octadec-9-enoxy]propan-2-yl]oxyoctadec-9-ene;N,N-dimethylmethanamine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(C)C(Cl)OCCCCCCCC/C=C\CCCCCCCC.CN(C)C |
| InChI | InChI=1S/C39H75ClO2.C3H9N/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-41-38(3)39(40)42-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;1-4(2)3/h18-21,38-39H,4-17,22-37H2,1-3H3;1-3H3/b20-18-,21-19-; |
| InChIKey | FDTGGRYUGOTFPU-YIQDKWKASA-N |
| XLogP | 14.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.59 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|