C8H7F8NO2 — CID 87085833
1,1,2,2,3,3,4,4-octafluoropentyl N-ethenylcarbamate (PubChem CID 87085833) has the molecular formula C8H7F8NO2 and a molecular weight of 301.13 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4-octafluoropentyl N-ethenylcarbamate.
| Compound Name | 1,1,2,2,3,3,4,4-octafluoropentyl N-ethenylcarbamate |
|---|---|
| PubChem CID | 87085833 |
| Molecular Formula | C8H7F8NO2 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1,1,2,2,3,3,4,4-octafluoropentyl N-ethenylcarbamate |
| SMILES | C=CNC(=O)OC(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C8H7F8NO2/c1-3-17-4(18)19-8(15,16)7(13,14)6(11,12)5(2,9)10/h3H,1H2,2H3,(H,17,18) |
| InChIKey | OKBOMWVSQVVWAU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|