C10H13NO6S — CID 87088424
1-(2-acetylpyridin-1-ium-1-yl)propan-2-one;hydrogen sulfate (PubChem CID 87088424) has the molecular formula C10H13NO6S and a molecular weight of 275.28 g/mol. Its IUPAC name is 1-(2-acetylpyridin-1-ium-1-yl)propan-2-one;hydrogen sulfate.
| Compound Name | 1-(2-acetylpyridin-1-ium-1-yl)propan-2-one;hydrogen sulfate |
|---|---|
| PubChem CID | 87088424 |
| Molecular Formula | C10H13NO6S |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | 1-(2-acetylpyridin-1-ium-1-yl)propan-2-one;hydrogen sulfate |
| SMILES | CC(=O)C[n+]1ccccc1C(C)=O.O=S(=O)([O-])O |
| InChI | InChI=1S/C10H12NO2.H2O4S/c1-8(12)7-11-6-4-3-5-10(11)9(2)13;1-5(2,3)4/h3-6H,7H2,1-2H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | RQDTZLFAQDIHHU-UHFFFAOYSA-M |
| XLogP | -0.23 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|