C6H7F4N2+ — CID 87105358
1-methyl-3-(1,1,2,2-tetrafluoroethyl)imidazol-1-ium (PubChem CID 87105358) has the molecular formula C6H7F4N2+ and a molecular weight of 183.13 g/mol. Its IUPAC name is 1-methyl-3-(1,1,2,2-tetrafluoroethyl)imidazol-1-ium.
| Compound Name | 1-methyl-3-(1,1,2,2-tetrafluoroethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 87105358 |
| Molecular Formula | C6H7F4N2+ |
| Molecular Weight | 183.13 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 1-methyl-3-(1,1,2,2-tetrafluoroethyl)imidazol-1-ium |
| SMILES | C[n+]1ccn(C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C6H7F4N2/c1-11-2-3-12(4-11)6(9,10)5(7)8/h2-5H,1H3/q+1 |
| InChIKey | YAUXRLZFQACJSH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.13 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|