C7H14NO- — CID 87114424
3,3-dimethyl-1-oxidopiperidine (PubChem CID 87114424) has the molecular formula C7H14NO- and a molecular weight of 128.19 g/mol. Its IUPAC name is 3,3-dimethyl-1-oxidopiperidine.
| Compound Name | 3,3-dimethyl-1-oxidopiperidine |
|---|---|
| PubChem CID | 87114424 |
| Molecular Formula | C7H14NO- |
| Molecular Weight | 128.19 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | 3,3-dimethyl-1-oxidopiperidine |
| SMILES | CC1(C)CCCN([O-])C1 |
| InChI | InChI=1S/C7H14NO/c1-7(2)4-3-5-8(9)6-7/h3-6H2,1-2H3/q-1 |
| InChIKey | DXKWJUDHZKADBY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.19 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |