C12H33NO7Si — CID 87115503
2-[bis(2-hydroxyethyl)amino]ethanol;butane-1,4-diol;dihydroxy(dimethyl)silane (PubChem CID 87115503) has the molecular formula C12H33NO7Si and a molecular weight of 331.48 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;butane-1,4-diol;dihydroxy(dimethyl)silane.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;butane-1,4-diol;dihydroxy(dimethyl)silane |
|---|---|
| PubChem CID | 87115503 |
| Molecular Formula | C12H33NO7Si |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;butane-1,4-diol;dihydroxy(dimethyl)silane |
| SMILES | C[Si](C)(O)O.OCCCCO.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C4H10O2.C2H8O2Si/c8-4-1-7(2-5-9)3-6-10;5-3-1-2-4-6;1-5(2,3)4/h8-10H,1-6H2;5-6H,1-4H2;3-4H,1-2H3 |
| InChIKey | DUCCQKSKYOCIIE-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 144.85 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|