C4H5N3OS2 — CID 87125746
(5-methyl-1,3,4-oxadiazol-2-yl)carbamodithioic acid (PubChem CID 87125746) has the molecular formula C4H5N3OS2 and a molecular weight of 175.24 g/mol. Its IUPAC name is (5-methyl-1,3,4-oxadiazol-2-yl)carbamodithioic acid.
| Compound Name | (5-methyl-1,3,4-oxadiazol-2-yl)carbamodithioic acid |
|---|---|
| PubChem CID | 87125746 |
| Molecular Formula | C4H5N3OS2 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 174.99 |
| IUPAC Name | (5-methyl-1,3,4-oxadiazol-2-yl)carbamodithioic acid |
| SMILES | Cc1nnc(NC(=S)S)o1 |
| InChI | InChI=1S/C4H5N3OS2/c1-2-6-7-3(8-2)5-4(9)10/h1H3,(H2,5,7,9,10) |
| InChIKey | WQZNSYAUECVGPO-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|