C15H17N3O5S — CID 87135223
3-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]-2-methoxypropanal (PubChem CID 87135223) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 3-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]-2-methoxypropanal.
| Compound Name | 3-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]-2-methoxypropanal |
|---|---|
| PubChem CID | 87135223 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3-[3-(3-amino-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)-2,6-dioxopiperidin-1-yl]-2-methoxypropanal |
| SMILES | COC(C=O)CN1C(=O)CCC(N2Cc3c(csc3N)C2=O)C1=O |
| InChI | InChI=1S/C15H17N3O5S/c1-23-8(6-19)4-18-12(20)3-2-11(15(18)22)17-5-9-10(14(17)21)7-24-13(9)16/h6-8,11H,2-5,16H2,1H3 |
| InChIKey | GXLIPHUOPPMTPQ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|