About acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride
acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride (PubChem CID 87151832) has the molecular formula C14H14ClN3O2S
and a molecular weight of 323.81 g/mol. Its IUPAC name is acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride.
Molecular Properties
| Compound Name | acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride |
| PubChem CID | 87151832 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride |
| SMILES | CC(=O)O.Nc1ccc2nc3ccc(=[NH2+])cc-3sc2c1.[Cl-] |
| InChI | InChI=1S/C12H9N3S.C2H4O2.ClH/c13-7-1-3-9-11(5-7)16-12-6-8(14)2-4-10(12)15-9;1-2(3)4;/h1-6,13H,14H2;1H3,(H,3,4);1H |
| InChIKey | WRSSRGKGTYLLCU-UHFFFAOYSA-N |
| XLogP | -2.26 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride?
The IUPAC name of acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride (CID 87151832) is acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride.
What is the SMILES notation for acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride?
The canonical SMILES for acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride is CC(=O)O.Nc1ccc2nc3ccc(=[NH2+])cc-3sc2c1.[Cl-].
What is the InChIKey of acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride?
The InChIKey is WRSSRGKGTYLLCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3S.C2H4O2.ClH/c13-7-1-3-9-11(5-7)16-12-6-8(14)2-4-10(12)15-9;1-2(3)4;/h1-6,13H,14H2;1H3,(H,3,4);1H.
What are the key properties of acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride?
acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride has a molecular weight of 323.81 g/mol, XLogP of -2.26, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;(7-aminophenothiazin-3-ylidene)azanium;chloride is sourced from PubChem (CID 87151832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).