About 6,6-dihydroxyhexoxyboronic acid
6,6-dihydroxyhexoxyboronic acid (PubChem CID 87179416) has the molecular formula C6H15BO5
and a molecular weight of 177.99 g/mol. Its IUPAC name is 6,6-dihydroxyhexoxyboronic acid.
Molecular Properties
| Compound Name | 6,6-dihydroxyhexoxyboronic acid |
| PubChem CID | 87179416 |
| Molecular Formula | C6H15BO5 |
| Molecular Weight | 177.99 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 6,6-dihydroxyhexoxyboronic acid |
| SMILES | OB(O)OCCCCCC(O)O |
| InChI | InChI=1S/C6H15BO5/c8-6(9)4-2-1-3-5-12-7(10)11/h6,8-11H,1-5H2 |
| InChIKey | JEFHKPYAKLLUMR-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.99 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dihydroxyhexoxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dihydroxyhexoxyboronic acid?
The IUPAC name of 6,6-dihydroxyhexoxyboronic acid (CID 87179416) is 6,6-dihydroxyhexoxyboronic acid.
What is the SMILES notation for 6,6-dihydroxyhexoxyboronic acid?
The canonical SMILES for 6,6-dihydroxyhexoxyboronic acid is OB(O)OCCCCCC(O)O.
What is the InChIKey of 6,6-dihydroxyhexoxyboronic acid?
The InChIKey is JEFHKPYAKLLUMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15BO5/c8-6(9)4-2-1-3-5-12-7(10)11/h6,8-11H,1-5H2.
What are the key properties of 6,6-dihydroxyhexoxyboronic acid?
6,6-dihydroxyhexoxyboronic acid has a molecular weight of 177.99 g/mol, XLogP of -1.16, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dihydroxyhexoxyboronic acid is sourced from PubChem (CID 87179416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).