C21H24N4O5 — CID 87180282
(3S)-4-oxo-3-[[(2R)-1-[5-(2-phenylethyl)-1H-imidazole-2-carbonyl]pyrrolidine-2-carbonyl]amino]butanoic acid (PubChem CID 87180282) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is (3S)-4-oxo-3-[[(2R)-1-[5-(2-phenylethyl)-1H-imidazole-2-carbonyl]pyrrolidine-2-carbonyl]amino]butanoic acid.
| Compound Name | (3S)-4-oxo-3-[[(2R)-1-[5-(2-phenylethyl)-1H-imidazole-2-carbonyl]pyrrolidine-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 87180282 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | (3S)-4-oxo-3-[[(2R)-1-[5-(2-phenylethyl)-1H-imidazole-2-carbonyl]pyrrolidine-2-carbonyl]amino]butanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NC(=O)[C@H]1CCCN1C(=O)c1ncc(CCc2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H24N4O5/c26-13-16(11-18(27)28)24-20(29)17-7-4-10-25(17)21(30)19-22-12-15(23-19)9-8-14-5-2-1-3-6-14/h1-3,5-6,12-13,16-17H,4,7-11H2,(H,22,23)(H,24,29)(H,27,28)/t16-,17+/m0/s1 |
| InChIKey | XAMWYRJLWXXTAY-DLBZAZTESA-N |
| XLogP | 0.96 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|