C24H32N4O5S — CID 87186642
5-butan-2-yl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione;5-cyclohex-2-en-1-yl-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 87186642) has the molecular formula C24H32N4O5S and a molecular weight of 488.61 g/mol. Its IUPAC name is 5-butan-2-yl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione;5-cyclohex-2-en-1-yl-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-butan-2-yl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione;5-cyclohex-2-en-1-yl-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 87186642 |
| Molecular Formula | C24H32N4O5S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | 5-butan-2-yl-5-prop-2-enyl-1,3-diazinane-2,4,6-trione;5-cyclohex-2-en-1-yl-5-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCC1(C(C)CC)C(=O)NC(=O)NC1=O.C=CCC1(C2C=CCCC2)C(=O)NC(=S)NC1=O |
| InChI | InChI=1S/C13H16N2O2S.C11H16N2O3/c1-2-8-13(9-6-4-3-5-7-9)10(16)14-12(18)15-11(13)17;1-4-6-11(7(3)5-2)8(14)12-10(16)13-9(11)15/h2,4,6,9H,1,3,5,7-8H2,(H2,14,15,16,17,18);4,7H,1,5-6H2,2-3H3,(H2,12,13,14,15,16) |
| InChIKey | ISABNWWVLTZUKM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|