C20H20F17N2+ — CID 87213330
1-cyclohexyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)imidazol-3-ium (PubChem CID 87213330) has the molecular formula C20H20F17N2+ and a molecular weight of 611.36 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)imidazol-3-ium.
| Compound Name | 1-cyclohexyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)imidazol-3-ium |
|---|---|
| PubChem CID | 87213330 |
| Molecular Formula | C20H20F17N2+ |
| Molecular Weight | 611.36 g/mol |
| Exact Mass | 611.13 |
| IUPAC Name | 1-cyclohexyl-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoroundecyl)imidazol-3-ium |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCC[n+]1ccn(C2CCCCC2)c1 |
| InChI | InChI=1S/C20H20F17N2/c21-13(22,7-4-8-38-9-10-39(11-38)12-5-2-1-3-6-12)14(23,24)15(25,26)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)37/h9-12H,1-8H2/q+1 |
| InChIKey | PIGPCYPAFWWRPO-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.36 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|