C19H33N2O4S+ — CID 8721975
2,4-diethoxy-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)benzenesulfonamide (PubChem CID 8721975) has the molecular formula C19H33N2O4S+ and a molecular weight of 385.55 g/mol. Its IUPAC name is 2,4-diethoxy-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)benzenesulfonamide.
| Compound Name | 2,4-diethoxy-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 8721975 |
| Molecular Formula | C19H33N2O4S+ |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 2,4-diethoxy-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC2CC(C)(C)[NH2+]C(C)(C)C2)c(OCC)c1 |
| InChI | InChI=1S/C19H32N2O4S/c1-7-24-15-9-10-17(16(11-15)25-8-2)26(22,23)20-14-12-18(3,4)21-19(5,6)13-14/h9-11,14,20-21H,7-8,12-13H2,1-6H3/p+1 |
| InChIKey | UTCRXEXWFCVBGA-UHFFFAOYSA-O |
| XLogP | 2.05 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |