C19H30N7O8P — CID 87223120
CID 87223120 (PubChem CID 87223120) has the molecular formula C19H30N7O8P and a molecular weight of 515.46 g/mol.
| Compound Name | CID 87223120 |
|---|---|
| PubChem CID | 87223120 |
| Molecular Formula | C19H30N7O8P |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | — |
| SMILES | CCCCN(OC[C@H]1O[C@@H](n2cnc3c(OC)nc(N)nc32)[C@](C)(O)[C@@H]1O)/[P+]([O-])=N/C(C)C(=O)O |
| InChI | InChI=1S/C19H30N7O8P/c1-5-6-7-26(35(31)24-10(2)16(28)29)33-8-11-13(27)19(3,30)17(34-11)25-9-21-12-14(25)22-18(20)23-15(12)32-4/h9-11,13,17,27,30H,5-8H2,1-4H3,(H,28,29)(H2,20,22,23)/t10?,11-,13-,17-,19-/m1/s1 |
| InChIKey | SNFHUWKGPQZGNO-FFCHPURHSA-N |
| XLogP | -0.21 |
| TPSA | 213.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|