C12H13N3O2S — CID 87238011
3-(2-sulfanyl-2,4-dihydro-1H-quinazolin-3-yl)pyrrolidine-2,5-dione (PubChem CID 87238011) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 3-(2-sulfanyl-2,4-dihydro-1H-quinazolin-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2-sulfanyl-2,4-dihydro-1H-quinazolin-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 87238011 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 3-(2-sulfanyl-2,4-dihydro-1H-quinazolin-3-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(N2Cc3ccccc3NC2S)C(=O)N1 |
| InChI | InChI=1S/C12H13N3O2S/c16-10-5-9(11(17)14-10)15-6-7-3-1-2-4-8(7)13-12(15)18/h1-4,9,12-13,18H,5-6H2,(H,14,16,17) |
| InChIKey | PBBDKZAGBGGERZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|