C14H11F6N3O2 — CID 87258329
3-(1,1,2,2,3,3-hexafluoropropoxy)-1-methyl-N-phenylpyrazole-4-carboxamide (PubChem CID 87258329) has the molecular formula C14H11F6N3O2 and a molecular weight of 367.25 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3-hexafluoropropoxy)-1-methyl-N-phenylpyrazole-4-carboxamide.
| Compound Name | 3-(1,1,2,2,3,3-hexafluoropropoxy)-1-methyl-N-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 87258329 |
| Molecular Formula | C14H11F6N3O2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 3-(1,1,2,2,3,3-hexafluoropropoxy)-1-methyl-N-phenylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccccc2)c(OC(F)(F)C(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C14H11F6N3O2/c1-23-7-9(10(24)21-8-5-3-2-4-6-8)11(22-23)25-14(19,20)13(17,18)12(15)16/h2-7,12H,1H3,(H,21,24) |
| InChIKey | FDSHASUUWVJZMW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|