C19H23F3N6O3 — CID 87264233
N-hydroxy-N-[2-[[[5-pyridin-4-yl-2-(trifluoromethyl)pyrimidin-4-yl]amino]carbamoyl]heptyl]formamide (PubChem CID 87264233) has the molecular formula C19H23F3N6O3 and a molecular weight of 440.43 g/mol. Its IUPAC name is N-hydroxy-N-[2-[[[5-pyridin-4-yl-2-(trifluoromethyl)pyrimidin-4-yl]amino]carbamoyl]heptyl]formamide.
| Compound Name | N-hydroxy-N-[2-[[[5-pyridin-4-yl-2-(trifluoromethyl)pyrimidin-4-yl]amino]carbamoyl]heptyl]formamide |
|---|---|
| PubChem CID | 87264233 |
| Molecular Formula | C19H23F3N6O3 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-hydroxy-N-[2-[[[5-pyridin-4-yl-2-(trifluoromethyl)pyrimidin-4-yl]amino]carbamoyl]heptyl]formamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNc1nc(C(F)(F)F)ncc1-c1ccncc1 |
| InChI | InChI=1S/C19H23F3N6O3/c1-2-3-4-5-14(11-28(31)12-29)17(30)27-26-16-15(13-6-8-23-9-7-13)10-24-18(25-16)19(20,21)22/h6-10,12,14,31H,2-5,11H2,1H3,(H,27,30)(H,24,25,26) |
| InChIKey | RHGYSOJQAVCJFO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 120.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|