C7H3ClF4 — CID 87290115
2-[chloro(deuterio)methyl]-1,3,4,5-tetrafluorobenzene (PubChem CID 87290115) has the molecular formula C7H3ClF4 and a molecular weight of 199.55 g/mol. Its IUPAC name is 2-[chloro(deuterio)methyl]-1,3,4,5-tetrafluorobenzene.
| Compound Name | 2-[chloro(deuterio)methyl]-1,3,4,5-tetrafluorobenzene |
|---|---|
| PubChem CID | 87290115 |
| Molecular Formula | C7H3ClF4 |
| Molecular Weight | 199.55 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | 2-[chloro(deuterio)methyl]-1,3,4,5-tetrafluorobenzene |
| SMILES | [2H]C(Cl)c1c(F)cc(F)c(F)c1F |
| InChI | InChI=1S/C7H3ClF4/c8-2-3-4(9)1-5(10)7(12)6(3)11/h1H,2H2/i2D |
| InChIKey | MJAWZQXEHKHHOK-VMNATFBRSA-N |
| XLogP | 2.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|