C27H34NO2PS — CID 87299159
[butyl(triphenyl)-λ5-phosphanyl] (2S)-2-amino-4-methylsulfanylbutanoate (PubChem CID 87299159) has the molecular formula C27H34NO2PS and a molecular weight of 467.62 g/mol. Its IUPAC name is [butyl(triphenyl)-λ5-phosphanyl] (2S)-2-amino-4-methylsulfanylbutanoate.
| Compound Name | [butyl(triphenyl)-λ5-phosphanyl] (2S)-2-amino-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 87299159 |
| Molecular Formula | C27H34NO2PS |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | [butyl(triphenyl)-λ5-phosphanyl] (2S)-2-amino-4-methylsulfanylbutanoate |
| SMILES | CCCCP(OC(=O)[C@@H](N)CCSC)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34NO2PS/c1-3-4-21-31(23-14-8-5-9-15-23,24-16-10-6-11-17-24,25-18-12-7-13-19-25)30-27(29)26(28)20-22-32-2/h5-19,26H,3-4,20-22,28H2,1-2H3/t26-/m0/s1 |
| InChIKey | XLTTWWKKRULHQH-SANMLTNESA-N |
| XLogP | 4.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|