About 4,7-diaminoheptyl formate
4,7-diaminoheptyl formate (PubChem CID 87299932) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is 4,7-diaminoheptyl formate.
Molecular Properties
| Compound Name | 4,7-diaminoheptyl formate |
| PubChem CID | 87299932 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 4,7-diaminoheptyl formate |
| SMILES | NCCCC(N)CCCOC=O |
| InChI | InChI=1S/C8H18N2O2/c9-5-1-3-8(10)4-2-6-12-7-11/h7-8H,1-6,9-10H2 |
| InChIKey | JIONINHXXCZOQM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,7-diaminoheptyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-diaminoheptyl formate?
The IUPAC name of 4,7-diaminoheptyl formate (CID 87299932) is 4,7-diaminoheptyl formate.
What is the SMILES notation for 4,7-diaminoheptyl formate?
The canonical SMILES for 4,7-diaminoheptyl formate is NCCCC(N)CCCOC=O.
What is the InChIKey of 4,7-diaminoheptyl formate?
The InChIKey is JIONINHXXCZOQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c9-5-1-3-8(10)4-2-6-12-7-11/h7-8H,1-6,9-10H2.
What are the key properties of 4,7-diaminoheptyl formate?
4,7-diaminoheptyl formate has a molecular weight of 174.24 g/mol, XLogP of 0.01, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-diaminoheptyl formate is sourced from PubChem (CID 87299932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).