C28H25F7N2O4S — CID 87300902
N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-2-[3-[methyl(methylsulfonylmethyl)carbamoyl]phenyl]benzamide (PubChem CID 87300902) has the molecular formula C28H25F7N2O4S and a molecular weight of 618.57 g/mol. Its IUPAC name is N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-2-[3-[methyl(methylsulfonylmethyl)carbamoyl]phenyl]benzamide.
| Compound Name | N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-2-[3-[methyl(methylsulfonylmethyl)carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 87300902 |
| Molecular Formula | C28H25F7N2O4S |
| Molecular Weight | 618.57 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylphenyl]-2-[3-[methyl(methylsulfonylmethyl)carbamoyl]phenyl]benzamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NC(=O)c1ccccc1-c1cccc(C(=O)N(C)CS(C)(=O)=O)c1 |
| InChI | InChI=1S/C28H25F7N2O4S/c1-16-12-20(26(29,27(30,31)32)28(33,34)35)13-17(2)23(16)36-24(38)22-11-6-5-10-21(22)18-8-7-9-19(14-18)25(39)37(3)15-42(4,40)41/h5-14H,15H2,1-4H3,(H,36,38) |
| InChIKey | CNMKBOFLKNTXCL-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |