C4H8NO6P — CID 87311662
CID 87311662 (PubChem CID 87311662) has the molecular formula C4H8NO6P and a molecular weight of 197.08 g/mol.
| Compound Name | CID 87311662 |
|---|---|
| PubChem CID | 87311662 |
| Molecular Formula | C4H8NO6P |
| Molecular Weight | 197.08 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | — |
| SMILES | N[C@](C(=O)O)([C@H](O)CO)P(=O)=O |
| InChI | InChI=1S/C4H8NO6P/c5-4(3(8)9,12(10)11)2(7)1-6/h2,6-7H,1,5H2,(H,8,9)/t2-,4-/m1/s1 |
| InChIKey | OFXZJZMELUZRBR-VVJJHMBFSA-N |
| XLogP | -1.75 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.08 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|