C9H20N2O3 — CID 87416618
3-amino-3-methylbutane-1,2-diol;2-methylprop-2-enamide (PubChem CID 87416618) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 3-amino-3-methylbutane-1,2-diol;2-methylprop-2-enamide.
| Compound Name | 3-amino-3-methylbutane-1,2-diol;2-methylprop-2-enamide |
|---|---|
| PubChem CID | 87416618 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 3-amino-3-methylbutane-1,2-diol;2-methylprop-2-enamide |
| SMILES | C=C(C)C(N)=O.CC(C)(N)C(O)CO |
| InChI | InChI=1S/C5H13NO2.C4H7NO/c1-5(2,6)4(8)3-7;1-3(2)4(5)6/h4,7-8H,3,6H2,1-2H3;1H2,2H3,(H2,5,6) |
| InChIKey | CPMPLHAAGXBYCZ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|