C23H30N2O6S2 — CID 87321966
3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propyl 4-methylbenzenesulfonate (PubChem CID 87321966) has the molecular formula C23H30N2O6S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87321966 |
| Molecular Formula | C23H30N2O6S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 3-[(2-tert-butyl-1,1-dihydroxy-3-oxo-5-phenyl-1,2-thiazol-4-yl)amino]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCNC2=C(c3ccccc3)S(O)(O)N(C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C23H30N2O6S2/c1-17-11-13-19(14-12-17)33(29,30)31-16-8-15-24-20-21(18-9-6-5-7-10-18)32(27,28)25(22(20)26)23(2,3)4/h5-7,9-14,24,27-28H,8,15-16H2,1-4H3 |
| InChIKey | AMGOYTCKFBQJAR-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|