C11H19F3N2O2 — CID 87322369
N-propan-2-yl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide (PubChem CID 87322369) has the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is N-propan-2-yl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide.
| Compound Name | N-propan-2-yl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 87322369 |
| Molecular Formula | C11H19F3N2O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-propan-2-yl-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
| SMILES | CC(C)NC(=O)CCCCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O2/c1-8(2)16-9(17)6-4-3-5-7-15-10(18)11(12,13)14/h8H,3-7H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | ZGPBIVDRCQYVPU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|