About calcium;dihydrogen borate;acetate
calcium;dihydrogen borate;acetate (PubChem CID 87324635) has the molecular formula C2H5BCaO5
and a molecular weight of 159.95 g/mol. Its IUPAC name is calcium;dihydrogen borate;acetate.
Molecular Properties
| Compound Name | calcium;dihydrogen borate;acetate |
| PubChem CID | 87324635 |
| Molecular Formula | C2H5BCaO5 |
| Molecular Weight | 159.95 g/mol |
| Exact Mass | 159.99 |
| IUPAC Name | calcium;dihydrogen borate;acetate |
| SMILES | CC(=O)[O-].[Ca+2].[O-]B(O)O |
| InChI | InChI=1S/C2H4O2.BH2O3.Ca/c1-2(3)4;2-1(3)4;/h1H3,(H,3,4);2-3H;/q;-1;+2/p-1 |
| InChIKey | XEHILSUIZRHMSX-UHFFFAOYSA-M |
| XLogP | -4.31 |
| TPSA | 103.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.95 |
| LogP ≤ 5 | -4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze calcium;dihydrogen borate;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;dihydrogen borate;acetate?
The IUPAC name of calcium;dihydrogen borate;acetate (CID 87324635) is calcium;dihydrogen borate;acetate.
What is the SMILES notation for calcium;dihydrogen borate;acetate?
The canonical SMILES for calcium;dihydrogen borate;acetate is CC(=O)[O-].[Ca+2].[O-]B(O)O.
What is the InChIKey of calcium;dihydrogen borate;acetate?
The InChIKey is XEHILSUIZRHMSX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.BH2O3.Ca/c1-2(3)4;2-1(3)4;/h1H3,(H,3,4);2-3H;/q;-1;+2/p-1.
What are the key properties of calcium;dihydrogen borate;acetate?
calcium;dihydrogen borate;acetate has a molecular weight of 159.95 g/mol, XLogP of -4.31, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;dihydrogen borate;acetate is sourced from PubChem (CID 87324635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).