C23H33IO4SSi — CID 87332383
[(3S)-4-iodo-1-phenyl-3-triethylsilyloxybutyl] 4-methylbenzenesulfonate (PubChem CID 87332383) has the molecular formula C23H33IO4SSi and a molecular weight of 560.57 g/mol. Its IUPAC name is [(3S)-4-iodo-1-phenyl-3-triethylsilyloxybutyl] 4-methylbenzenesulfonate.
| Compound Name | [(3S)-4-iodo-1-phenyl-3-triethylsilyloxybutyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87332383 |
| Molecular Formula | C23H33IO4SSi |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.09 |
| IUPAC Name | [(3S)-4-iodo-1-phenyl-3-triethylsilyloxybutyl] 4-methylbenzenesulfonate |
| SMILES | CC[Si](CC)(CC)O[C@H](CI)CC(OS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H33IO4SSi/c1-5-30(6-2,7-3)28-21(18-24)17-23(20-11-9-8-10-12-20)27-29(25,26)22-15-13-19(4)14-16-22/h8-16,21,23H,5-7,17-18H2,1-4H3/t21-,23?/m0/s1 |
| InChIKey | NMGQNOSBWOBAMJ-BBQAJUCSSA-N |
| XLogP | 6.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|