C14H19F9O2S — CID 87339831
ethyl 3-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)butanoate (PubChem CID 87339831) has the molecular formula C14H19F9O2S and a molecular weight of 422.35 g/mol. Its IUPAC name is ethyl 3-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)butanoate.
| Compound Name | ethyl 3-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)butanoate |
|---|---|
| PubChem CID | 87339831 |
| Molecular Formula | C14H19F9O2S |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | ethyl 3-methyl-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)butanoate |
| SMILES | CCOC(=O)C(SCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C14H19F9O2S/c1-4-25-10(24)9(8(2)3)26-7-5-6-11(15,16)12(17,18)13(19,20)14(21,22)23/h8-9H,4-7H2,1-3H3 |
| InChIKey | SSNCBDKGNPRQLY-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|