C11H17F5O2S — CID 87340807
methyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate (PubChem CID 87340807) has the molecular formula C11H17F5O2S and a molecular weight of 308.31 g/mol. Its IUPAC name is methyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate.
| Compound Name | methyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate |
|---|---|
| PubChem CID | 87340807 |
| Molecular Formula | C11H17F5O2S |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | methyl 3-methyl-2-(4,4,5,5,5-pentafluoropentylsulfanyl)butanoate |
| SMILES | COC(=O)C(SCCCC(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H17F5O2S/c1-7(2)8(9(17)18-3)19-6-4-5-10(12,13)11(14,15)16/h7-8H,4-6H2,1-3H3 |
| InChIKey | LEIIAOGVPDHWJW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|