C19H36O7 — CID 87352199
6-O-(4,9-dihydroxy-2,2-dimethylnonan-3-yl) 1-O-(2-hydroxyethyl) hexanedioate (PubChem CID 87352199) has the molecular formula C19H36O7 and a molecular weight of 376.49 g/mol. Its IUPAC name is 6-O-(4,9-dihydroxy-2,2-dimethylnonan-3-yl) 1-O-(2-hydroxyethyl) hexanedioate.
| Compound Name | 6-O-(4,9-dihydroxy-2,2-dimethylnonan-3-yl) 1-O-(2-hydroxyethyl) hexanedioate |
|---|---|
| PubChem CID | 87352199 |
| Molecular Formula | C19H36O7 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 6-O-(4,9-dihydroxy-2,2-dimethylnonan-3-yl) 1-O-(2-hydroxyethyl) hexanedioate |
| SMILES | CC(C)(C)C(OC(=O)CCCCC(=O)OCCO)C(O)CCCCCO |
| InChI | InChI=1S/C19H36O7/c1-19(2,3)18(15(22)9-5-4-8-12-20)26-17(24)11-7-6-10-16(23)25-14-13-21/h15,18,20-22H,4-14H2,1-3H3 |
| InChIKey | YXXAABSLELWFMK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|