C15H16F3I2N3Pt — CID 87352335
N,N-diiodo-1-[4-(trifluoromethyl)phenyl]methanamine;(1-methyl-3-prop-2-enylimidazol-2-ylidene)platinum (PubChem CID 87352335) has the molecular formula C15H16F3I2N3Pt and a molecular weight of 744.19 g/mol. Its IUPAC name is N,N-diiodo-1-[4-(trifluoromethyl)phenyl]methanamine;(1-methyl-3-prop-2-enylimidazol-2-ylidene)platinum.
| Compound Name | N,N-diiodo-1-[4-(trifluoromethyl)phenyl]methanamine;(1-methyl-3-prop-2-enylimidazol-2-ylidene)platinum |
|---|---|
| PubChem CID | 87352335 |
| Molecular Formula | C15H16F3I2N3Pt |
| Molecular Weight | 744.19 g/mol |
| Exact Mass | 743.90 |
| IUPAC Name | N,N-diiodo-1-[4-(trifluoromethyl)phenyl]methanamine;(1-methyl-3-prop-2-enylimidazol-2-ylidene)platinum |
| SMILES | C=CCn1ccn(C)c1=[Pt].FC(F)(F)c1ccc(CN(I)I)cc1 |
| InChI | InChI=1S/C8H6F3I2N.C7H10N2.Pt/c9-8(10,11)7-3-1-6(2-4-7)5-14(12)13;1-3-4-9-6-5-8(2)7-9;/h1-4H,5H2;3,5-6H,1,4H2,2H3; |
| InChIKey | QWOXERGNZUOHIS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 13.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.19 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|