C27H33ClN4O4 — CID 87353306
(2S)-2-[[(2R)-2,6-diaminohexanoyl]-(1-oxo-4-phenylbut-1-en-2-yl)amino]-3-(1H-indol-3-yl)propanoic acid;hydrochloride (PubChem CID 87353306) has the molecular formula C27H33ClN4O4 and a molecular weight of 513.04 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2,6-diaminohexanoyl]-(1-oxo-4-phenylbut-1-en-2-yl)amino]-3-(1H-indol-3-yl)propanoic acid;hydrochloride.
| Compound Name | (2S)-2-[[(2R)-2,6-diaminohexanoyl]-(1-oxo-4-phenylbut-1-en-2-yl)amino]-3-(1H-indol-3-yl)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 87353306 |
| Molecular Formula | C27H33ClN4O4 |
| Molecular Weight | 513.04 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | (2S)-2-[[(2R)-2,6-diaminohexanoyl]-(1-oxo-4-phenylbut-1-en-2-yl)amino]-3-(1H-indol-3-yl)propanoic acid;hydrochloride |
| SMILES | Cl.NCCCC[C@@H](N)C(=O)N(C(=C=O)CCc1ccccc1)[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C27H32N4O4.ClH/c28-15-7-6-11-23(29)26(33)31(21(18-32)14-13-19-8-2-1-3-9-19)25(27(34)35)16-20-17-30-24-12-5-4-10-22(20)24;/h1-5,8-10,12,17,23,25,30H,6-7,11,13-16,28-29H2,(H,34,35);1H/t23-,25+;/m1./s1 |
| InChIKey | HMECECLWGLRWAD-BUDDBBPTSA-N |
| XLogP | 3.22 |
| TPSA | 142.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.04 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|