C5H7F5O2Sn — CID 87373132
methoxy-oxo-(1,1,4,4,4-pentafluorobutyl)tin (PubChem CID 87373132) has the molecular formula C5H7F5O2Sn and a molecular weight of 312.81 g/mol. Its IUPAC name is methoxy-oxo-(1,1,4,4,4-pentafluorobutyl)tin.
| Compound Name | methoxy-oxo-(1,1,4,4,4-pentafluorobutyl)tin |
|---|---|
| PubChem CID | 87373132 |
| Molecular Formula | C5H7F5O2Sn |
| Molecular Weight | 312.81 g/mol |
| Exact Mass | 313.94 |
| IUPAC Name | methoxy-oxo-(1,1,4,4,4-pentafluorobutyl)tin |
| SMILES | CO[Sn](=O)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C4H4F5.CH3O.O.Sn/c5-3(6)1-2-4(7,8)9;1-2;;/h1-2H2;1H3;;/q;-1;;+1 |
| InChIKey | NDUGELRSKOGPHV-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.81 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |