C6H7F7O2Sn — CID 87372541
ethoxy-(1,1,2,2,4,4,4-heptafluorobutyl)-oxotin (PubChem CID 87372541) has the molecular formula C6H7F7O2Sn and a molecular weight of 362.82 g/mol. Its IUPAC name is ethoxy-(1,1,2,2,4,4,4-heptafluorobutyl)-oxotin.
| Compound Name | ethoxy-(1,1,2,2,4,4,4-heptafluorobutyl)-oxotin |
|---|---|
| PubChem CID | 87372541 |
| Molecular Formula | C6H7F7O2Sn |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | ethoxy-(1,1,2,2,4,4,4-heptafluorobutyl)-oxotin |
| SMILES | CCO[Sn](=O)C(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C4H2F7.C2H5O.O.Sn/c5-2(6)3(7,8)1-4(9,10)11;1-2-3;;/h1H2;2H2,1H3;;/q;-1;;+1 |
| InChIKey | IWNLEBKEILUZSQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|