C12H17F3O2Sn — CID 175260809
benzene;ethoxy-oxo-(4,4,4-trifluorobutyl)tin (PubChem CID 175260809) has the molecular formula C12H17F3O2Sn and a molecular weight of 368.97 g/mol. Its IUPAC name is benzene;ethoxy-oxo-(4,4,4-trifluorobutyl)tin.
| Compound Name | benzene;ethoxy-oxo-(4,4,4-trifluorobutyl)tin |
|---|---|
| PubChem CID | 175260809 |
| Molecular Formula | C12H17F3O2Sn |
| Molecular Weight | 368.97 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | benzene;ethoxy-oxo-(4,4,4-trifluorobutyl)tin |
| SMILES | CCO[Sn](=O)CCCC(F)(F)F.c1ccccc1 |
| InChI | InChI=1S/C6H6.C4H6F3.C2H5O.O.Sn/c1-2-4-6-5-3-1;1-2-3-4(5,6)7;1-2-3;;/h1-6H;1-3H2;2H2,1H3;;/q;;-1;;+1 |
| InChIKey | VJLJWDSTUYRSIO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |