C47H35BrO2 — CID 87380804
18-bromo-21,21-dimethyl-5,12-bis(4-phenylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3,6,8,10,13,15(20),16,18-nonaene-5,12-diol (PubChem CID 87380804) has the molecular formula C47H35BrO2 and a molecular weight of 711.70 g/mol. Its IUPAC name is 18-bromo-21,21-dimethyl-5,12-bis(4-phenylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3,6,8,10,13,15(20),16,18-nonaene-5,12-diol.
| Compound Name | 18-bromo-21,21-dimethyl-5,12-bis(4-phenylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3,6,8,10,13,15(20),16,18-nonaene-5,12-diol |
|---|---|
| PubChem CID | 87380804 |
| Molecular Formula | C47H35BrO2 |
| Molecular Weight | 711.70 g/mol |
| Exact Mass | 710.18 |
| IUPAC Name | 18-bromo-21,21-dimethyl-5,12-bis(4-phenylphenyl)pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3,6,8,10,13,15(20),16,18-nonaene-5,12-diol |
| SMILES | CC1(C)C2=CC3=C4C(=CC=CC4(O)c4ccc(-c5ccccc5)cc4)C=C3C(O)(c3ccc(-c4ccccc4)cc3)C2=Cc2ccc(Br)cc21 |
| InChI | InChI=1S/C47H35BrO2/c1-45(2)40-28-38(48)24-19-34(40)26-43-42(45)29-39-41(47(43,50)37-22-17-33(18-23-37)31-12-7-4-8-13-31)27-35-14-9-25-46(49,44(35)39)36-20-15-32(16-21-36)30-10-5-3-6-11-30/h3-29,49-50H,1-2H3 |
| InChIKey | JROPBMLWMOCDSO-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.70 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |