C13H15F3N2O4 — CID 87387539
4-(methylamino)-2-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid (PubChem CID 87387539) has the molecular formula C13H15F3N2O4 and a molecular weight of 320.27 g/mol. Its IUPAC name is 4-(methylamino)-2-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid.
| Compound Name | 4-(methylamino)-2-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid |
|---|---|
| PubChem CID | 87387539 |
| Molecular Formula | C13H15F3N2O4 |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 4-(methylamino)-2-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]benzoic acid |
| SMILES | CNc1ccc(C(=O)O)c(OCCCNC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3N2O4/c1-17-8-3-4-9(11(19)20)10(7-8)22-6-2-5-18-12(21)13(14,15)16/h3-4,7,17H,2,5-6H2,1H3,(H,18,21)(H,19,20) |
| InChIKey | MPAYHXSOYVJBLQ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|