C20H14NO6S+ — CID 87392086
2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pyrene-1-sulfonic acid (PubChem CID 87392086) has the molecular formula C20H14NO6S+ and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pyrene-1-sulfonic acid.
| Compound Name | 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pyrene-1-sulfonic acid |
|---|---|
| PubChem CID | 87392086 |
| Molecular Formula | C20H14NO6S+ |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 2-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)pyrene-1-sulfonic acid |
| SMILES | O=C1CCC(=O)[N+]1(O)c1cc2ccc3cccc4ccc(c1S(=O)(=O)O)c2c34 |
| InChI | InChI=1S/C20H13NO6S/c22-16-8-9-17(23)21(16,24)15-10-13-5-4-11-2-1-3-12-6-7-14(19(13)18(11)12)20(15)28(25,26)27/h1-7,10,24H,8-9H2/p+1 |
| InChIKey | MFVVPZZGHKNTJX-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|