About bis(oxomethylidene)iron;1H-inden-1-ide;bromide
bis(oxomethylidene)iron;1H-inden-1-ide;bromide (PubChem CID 87399398) has the molecular formula C11H7BrFeO2-2
and a molecular weight of 306.92 g/mol. Its IUPAC name is bis(oxomethylidene)iron;1H-inden-1-ide;bromide.
Molecular Properties
| Compound Name | bis(oxomethylidene)iron;1H-inden-1-ide;bromide |
| PubChem CID | 87399398 |
| Molecular Formula | C11H7BrFeO2-2 |
| Molecular Weight | 306.92 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | bis(oxomethylidene)iron;1H-inden-1-ide;bromide |
| SMILES | O=C=[Fe]=C=O.[Br-].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.2CO.BrH.Fe/c1-2-5-9-7-3-6-8(9)4-1;2*1-2;;/h1-7H;;;1H;/q-1;;;;/p-1 |
| InChIKey | XBZIZMXEDGZRCI-UHFFFAOYSA-M |
| XLogP | -1.23 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.92 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(oxomethylidene)iron;1H-inden-1-ide;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(oxomethylidene)iron;1H-inden-1-ide;bromide?
The IUPAC name of bis(oxomethylidene)iron;1H-inden-1-ide;bromide (CID 87399398) is bis(oxomethylidene)iron;1H-inden-1-ide;bromide.
What is the SMILES notation for bis(oxomethylidene)iron;1H-inden-1-ide;bromide?
The canonical SMILES for bis(oxomethylidene)iron;1H-inden-1-ide;bromide is O=C=[Fe]=C=O.[Br-].c1ccc2[cH-]ccc2c1.
What is the InChIKey of bis(oxomethylidene)iron;1H-inden-1-ide;bromide?
The InChIKey is XBZIZMXEDGZRCI-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H7.2CO.BrH.Fe/c1-2-5-9-7-3-6-8(9)4-1;2*1-2;;/h1-7H;;;1H;/q-1;;;;/p-1.
What are the key properties of bis(oxomethylidene)iron;1H-inden-1-ide;bromide?
bis(oxomethylidene)iron;1H-inden-1-ide;bromide has a molecular weight of 306.92 g/mol, XLogP of -1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(oxomethylidene)iron;1H-inden-1-ide;bromide is sourced from PubChem (CID 87399398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).